ChemNet > CAS > 31909-58-7 2-Furoylacetonitrile
31909-58-7 2-Furoylacetonitrile
| produktnavn |
2-Furoylacetonitrile |
| Engelsk navn |
2-Furoylacetonitrile;3-(furan-2-yl)-3-oxopropanenitrile |
| Molekylær Formel |
C7H5NO2 |
| Molekylvekt |
135.1201 |
| InChI |
InChI=1/C7H5NO2/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
| CAS-nummer |
31909-58-7 |
| Molecular Structure |
|
| Tetthet |
1.188g/cm3 |
| Smeltepunkt |
76-83℃ |
| Kokepunkt |
297.2°C at 760 mmHg |
| Brytningsindeks |
1.494 |
| Flammepunktet |
133.6°C |
| Damptrykk |
0.00137mmHg at 25°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
