ChemNet > CAS > 3260-88-6 3-Chloro-2-methylanisole,98%
3260-88-6 3-Chloro-2-methylanisole,98%
produktnavn |
3-Chloro-2-methylanisole,98% |
Engelsk navn |
3-Chloro-2-methylanisole,98%; 3-Chloro-2-methylanisole; 2-Chloro-6-methoxytoluene~2-Methoxy-6-chlorotoluene; 1-chloro-3-methoxy-2-methylbenzene |
Molekylær Formel |
C8H9ClO |
Molekylvekt |
156.6095 |
InChI |
InChI=1/C8H9ClO/c1-6-7(9)4-3-5-8(6)10-2/h3-5H,1-2H3 |
CAS-nummer |
3260-88-6 |
EINECS |
221-862-6 |
Molecular Structure |
|
Tetthet |
1.105g/cm3 |
Kokepunkt |
201.9°C at 760 mmHg |
Brytningsindeks |
1.514 |
Flammepunktet |
82.1°C |
Damptrykk |
0.427mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|