ChemNet > CAS > 32852-81-6 3-Phenoxyphenylacetic acid
32852-81-6 3-Phenoxyphenylacetic acid
produktnavn |
3-Phenoxyphenylacetic acid |
Engelsk navn |
3-Phenoxyphenylacetic acid; 3-Phenoxyphenylacetic |
Molekylær Formel |
C14H12O3 |
Molekylvekt |
228.2433 |
InChI |
InChI=1/C14H12O3/c15-14(16)10-11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-9H,10H2,(H,15,16) |
CAS-nummer |
32852-81-6 |
Molecular Structure |
|
Tetthet |
1.217g/cm3 |
Kokepunkt |
385.4°C at 760 mmHg |
Brytningsindeks |
1.596 |
Flammepunktet |
147.4°C |
Damptrykk |
1.25E-06mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|