33155-90-7 Hydroxybenzoquinoline
produktnavn |
Hydroxybenzoquinoline |
Engelsk navn |
Hydroxybenzoquinoline; 10-Hydroxybenzo[h]quinoline; benzo[h]quinolin-10-ol |
Molekylær Formel |
C13H9NO |
Molekylvekt |
195.2167 |
InChI |
InChI=1/C13H9NO/c15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11/h1-8,15H |
CAS-nummer |
33155-90-7 |
Molecular Structure |
|
Tetthet |
1.307g/cm3 |
Kokepunkt |
420.621°C at 760 mmHg |
Brytningsindeks |
1.768 |
Flammepunktet |
208.184°C |
Damptrykk |
0mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|