ChemNet > CAS > 33524-31-1 2,5-Dimethoxybenzyl alcohol
33524-31-1 2,5-Dimethoxybenzyl alcohol
| produktnavn |
2,5-Dimethoxybenzyl alcohol |
| Engelsk navn |
2,5-Dimethoxybenzyl alcohol;(2,5-dimethoxyphenyl)methanol |
| Molekylær Formel |
C9H12O3 |
| Molekylvekt |
168.1898 |
| InChI |
InChI=1/C9H12O3/c1-11-8-3-4-9(12-2)7(5-8)6-10/h3-5,10H,6H2,1-2H3 |
| CAS-nummer |
33524-31-1 |
| EINECS |
251-562-0 |
| Molecular Structure |
|
| Tetthet |
1.111g/cm3 |
| Kokepunkt |
305.6°C at 760 mmHg |
| Brytningsindeks |
1.521 |
| Flammepunktet |
127.7°C |
| Damptrykk |
0.000354mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
