33775-94-9 2-Iodothioanisole
produktnavn |
2-Iodothioanisole |
Engelsk navn |
2-Iodothioanisole; 2-Iodophenyl methyl sulphide~2-(Methylthio)iodobenzene; 1-Iodo-2-(methylthio)benzene; 1-iodo-2-(methylsulfanyl)benzene |
Molekylær Formel |
C7H7IS |
Molekylvekt |
250.0999 |
InChI |
InChI=1/C7H7IS/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
CAS-nummer |
33775-94-9 |
Molecular Structure |
|
Tetthet |
1.78g/cm3 |
Kokepunkt |
253°C at 760 mmHg |
Brytningsindeks |
1.67 |
Flammepunktet |
106.8°C |
Damptrykk |
0.0298mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|