ChemNet > CAS > 345-70-0 3,3'-difluorobenzophenone
345-70-0 3,3'-difluorobenzophenone
| produktnavn |
3,3'-difluorobenzophenone |
| Engelsk navn |
3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone |
| Molekylær Formel |
C13H8F2O |
| Molekylvekt |
218.1988 |
| InChI |
InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
| CAS-nummer |
345-70-0 |
| Molecular Structure |
|
| Tetthet |
1.239g/cm3 |
| Smeltepunkt |
56-59℃ |
| Kokepunkt |
316.2°C at 760 mmHg |
| Brytningsindeks |
1.549 |
| Flammepunktet |
121.3°C |
| Damptrykk |
0.000415mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
