ChemNet > CAS > 35354-29-1 3,5-Diacetoxy Benzoic Acid
35354-29-1 3,5-Diacetoxy Benzoic Acid
| produktnavn |
3,5-Diacetoxy Benzoic Acid |
| Engelsk navn |
3,5-Diacetoxy Benzoic Acid; 3,5-Diacetoxybenzoic acid; 3,5-bis(acetyloxy)benzoic acid |
| Molekylær Formel |
C11H10O6 |
| Molekylvekt |
238.1935 |
| InChI |
InChI=1/C11H10O6/c1-6(12)16-9-3-8(11(14)15)4-10(5-9)17-7(2)13/h3-5H,1-2H3,(H,14,15) |
| CAS-nummer |
35354-29-1 |
| Molecular Structure |
|
| Tetthet |
1.344g/cm3 |
| Kokepunkt |
408.4°C at 760 mmHg |
| Brytningsindeks |
1.543 |
| Flammepunktet |
160.4°C |
| Damptrykk |
2.1E-07mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
