ChemNet > CAS > 35364-79-5 3,4-Dichlorophenethylalcohol
35364-79-5 3,4-Dichlorophenethylalcohol
| produktnavn |
3,4-Dichlorophenethylalcohol |
| Engelsk navn |
3,4-Dichlorophenethylalcohol; 2-(3,4-dichlorophenyl)ethanol; 3,4-Dichlorophenethyl alcohol |
| Molekylær Formel |
C8H8Cl2O |
| Molekylvekt |
191.0545 |
| InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5,11H,3-4H2 |
| CAS-nummer |
35364-79-5 |
| Molecular Structure |
|
| Tetthet |
1.329g/cm3 |
| Kokepunkt |
279.1°C at 760 mmHg |
| Brytningsindeks |
1.569 |
| Flammepunktet |
117.9°C |
| Damptrykk |
0.00196mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
