ChemNet > CAS > 35553-92-5 ethyl 2-(3-methoxyphenyl)acetate
35553-92-5 ethyl 2-(3-methoxyphenyl)acetate
produktnavn |
ethyl 2-(3-methoxyphenyl)acetate |
Engelsk navn |
ethyl 2-(3-methoxyphenyl)acetate; Ethyl 3-methoxyphenylacetate |
Molekylær Formel |
C11H14O3 |
Molekylvekt |
194.2271 |
InChI |
InChI=1/C11H14O3/c1-3-14-11(12)8-9-5-4-6-10(7-9)13-2/h4-7H,3,8H2,1-2H3 |
CAS-nummer |
35553-92-5 |
EINECS |
252-614-5 |
Molecular Structure |
|
Tetthet |
1.062g/cm3 |
Kokepunkt |
271.6°C at 760 mmHg |
Brytningsindeks |
1.497 |
Flammepunktet |
108.5°C |
Damptrykk |
0.00637mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|