ChemNet > CAS > 36255-44-4 3-bromopropionaldehyde dimethyl acetal
36255-44-4 3-bromopropionaldehyde dimethyl acetal
produktnavn |
3-bromopropionaldehyde dimethyl acetal |
Engelsk navn |
3-bromopropionaldehyde dimethyl acetal; 1-Bromo-3,3-dimethoxypropane; 3-bromo-1,1-dimethoxypropane |
Molekylær Formel |
C5H11BrO2 |
Molekylvekt |
183.0436 |
InChI |
InChI=1/C5H11BrO2/c1-7-5(8-2)3-4-6/h5H,3-4H2,1-2H3 |
CAS-nummer |
36255-44-4 |
EINECS |
252-936-6 |
Molecular Structure |
|
Tetthet |
1.332g/cm3 |
Kokepunkt |
164.8°C at 760 mmHg |
Brytningsindeks |
1.442 |
Flammepunktet |
14°C |
Damptrykk |
2.54mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|