ChemNet > CAS > 3681-71-8 cis-3-hexenyl acetate
3681-71-8 cis-3-hexenyl acetate
| produktnavn |
cis-3-hexenyl acetate |
| Engelsk navn |
cis-3-hexenyl acetate; Cis-3-Hexene-1-Yl Acetate; 3-Hexen-1-ol, acetate, (Z)-; ACETATO DE CIS-3-HEXENILO; Leaf acetate; Verdural extra; (Z)-3-hexenyl acetate |
| Molekylær Formel |
C8H14O2 |
| Molekylvekt |
142.2 |
| InChI |
InChI=1/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h4-5H,3,6-7H2,1-2H3/b5-4- |
| CAS-nummer |
3681-71-8 |
| EINECS |
222-960-1 |
| Molecular Structure |
|
| Tetthet |
0.897 |
| Kokepunkt |
75-76℃ (23 mmHg) |
| Brytningsindeks |
1.427 |
| Flammepunktet |
135�H |
| Hazard symboler |
|
| Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
