ChemNet > CAS > 36919-03-6 Methyl pentafluorophenyl carbonate
36919-03-6 Methyl pentafluorophenyl carbonate
produktnavn |
Methyl pentafluorophenyl carbonate |
Engelsk navn |
Methyl pentafluorophenyl carbonate; Pentafluorophenyl methyl carbonate |
Molekylær Formel |
C8H3F5O3 |
Molekylvekt |
242.0996 |
InChI |
InChI=1/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
CAS-nummer |
36919-03-6 |
Molecular Structure |
|
Tetthet |
1.567g/cm3 |
Kokepunkt |
207.5°C at 760 mmHg |
Brytningsindeks |
1.422 |
Flammepunktet |
77.3°C |
Damptrykk |
0.224mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|