ChemNet > CAS > 374537-99-2 7-Amino-5-bromoindole
374537-99-2 7-Amino-5-bromoindole
| produktnavn |
7-Amino-5-bromoindole |
| Engelsk navn |
7-Amino-5-bromoindole; 5-Bromo-7-indolamine; 5-bromo-1H-indol-7-amine |
| Molekylær Formel |
C8H7BrN2 |
| Molekylvekt |
211.0586 |
| InChI |
InChI=1/C8H7BrN2/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,11H,10H2 |
| CAS-nummer |
374537-99-2 |
| Molecular Structure |
|
| Tetthet |
1.753g/cm3 |
| Kokepunkt |
405.6°C at 760 mmHg |
| Brytningsindeks |
1.779 |
| Flammepunktet |
199.1°C |
| Damptrykk |
8.68E-07mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
