ChemNet > CAS > 37529-27-4 4-heptylaniline
37529-27-4 4-heptylaniline
| produktnavn |
4-heptylaniline |
| Engelsk navn |
4-heptylaniline; Heptylaniline; 4-n-Heptyaniline |
| Molekylær Formel |
C13H21N |
| Molekylvekt |
191.3125 |
| InChI |
InChI=1/C13H21N/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7,14H2,1H3 |
| CAS-nummer |
37529-27-4 |
| Molecular Structure |
|
| Tetthet |
0.923g/cm3 |
| Kokepunkt |
282.9°C at 760 mmHg |
| Brytningsindeks |
1.522 |
| Flammepunktet |
128.9°C |
| Damptrykk |
0.00327mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
