ChemNet > CAS > 3779-27-9 2,2'-Bithienyl-5-carboxaldehyde
3779-27-9 2,2'-Bithienyl-5-carboxaldehyde
produktnavn |
2,2'-Bithienyl-5-carboxaldehyde |
Engelsk navn |
2,2'-Bithienyl-5-carboxaldehyde; 2,2-Bithiophene-5-carboxaldehyde; 2,2-Bithienyl-5-carboxaldehyde; 2,2'-bithiophene-5-carbaldehyde |
Molekylær Formel |
C9H6OS2 |
Molekylvekt |
194.2733 |
InChI |
InChI=1/C9H6OS2/c10-6-7-3-4-9(12-7)8-2-1-5-11-8/h1-6H |
CAS-nummer |
3779-27-9 |
Molecular Structure |
|
Tetthet |
1.336g/cm3 |
Smeltepunkt |
57℃ |
Kokepunkt |
340°C at 760 mmHg |
Brytningsindeks |
1.671 |
Flammepunktet |
159.4°C |
Damptrykk |
8.85E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|