ChemNet > CAS > 38071-22-6 4,5-Dibromothiophene-2-carboxaldehyde
38071-22-6 4,5-Dibromothiophene-2-carboxaldehyde
produktnavn |
4,5-Dibromothiophene-2-carboxaldehyde |
Engelsk navn |
4,5-Dibromothiophene-2-carboxaldehyde;4,5-dibromothiophene-2-carbaldehyde |
Molekylær Formel |
C5H2Br2OS |
Molekylvekt |
269.9418 |
InChI |
InChI=1/C5H2Br2OS/c6-4-1-3(2-8)9-5(4)7/h1-2H |
CAS-nummer |
38071-22-6 |
Molecular Structure |
|
Tetthet |
2.195g/cm3 |
Smeltepunkt |
79℃ |
Kokepunkt |
306.1°C at 760 mmHg |
Brytningsindeks |
1.685 |
Flammepunktet |
138.9°C |
Damptrykk |
0.00079mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|