ChemNet > CAS > 384-67-8 Chlorodifluoroacetophenone
384-67-8 Chlorodifluoroacetophenone
produktnavn |
Chlorodifluoroacetophenone |
Engelsk navn |
Chlorodifluoroacetophenone; 2-Chloro-2,2-difluoro-1-phenylethanone; 2-Chloro-2,2-difluoroacetophenone; alpha-Chloro-alpha,alpha-difluoroacetophene; ethanone, 2-chloro-2,2-difluoro-1-phenyl-; GXFFVR; N-(2-fluorophenyl)-β-alanine; 2,2-Difluoro-2-chloroacetophenone; 2,2,2-Chlorodifluoroacetophenone |
Molekylær Formel |
C9H10FNO2 |
Molekylvekt |
183.1796 |
InChI |
InChI=1/C9H10FNO2/c10-7-3-1-2-4-8(7)11-6-5-9(12)13/h1-4,11H,5-6H2,(H,12,13) |
CAS-nummer |
384-67-8 |
Molecular Structure |
|
Tetthet |
1.301g/cm3 |
Kokepunkt |
357.2°C at 760 mmHg |
Brytningsindeks |
1.577 |
Flammepunktet |
169.8°C |
Damptrykk |
1.01E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|