38460-95-6 10-Undecenoyl chloride
produktnavn |
10-Undecenoyl chloride |
Engelsk navn |
10-Undecenoyl chloride; Undecenoylchloride; ; 10-Undeconyl chloride |
Molekylær Formel |
C11H19ClO |
Molekylvekt |
202.72 |
InChI |
InChI=1/C11H19ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2H,1,3-10H2 |
CAS-nummer |
38460-95-6 |
EINECS |
253-951-0 |
Molecular Structure |
|
Tetthet |
0.94 |
Kokepunkt |
120-122℃ (10 torr) |
Brytningsindeks |
1.4532-1.4552 |
Flammepunktet |
93℃ |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|