ChemNet > CAS > 3879-08-1 4-Hydroxybutyric acid hydrazide
3879-08-1 4-Hydroxybutyric acid hydrazide
produktnavn |
4-Hydroxybutyric acid hydrazide |
Engelsk navn |
4-Hydroxybutyric acid hydrazide; 4-Hydroxybutanoic hydrazide; 4-hydroxybutanehydrazide |
Molekylær Formel |
C4H10N2O2 |
Molekylvekt |
118.1344 |
InChI |
InChI=1/C4H10N2O2/c5-6-4(8)2-1-3-7/h7H,1-3,5H2,(H,6,8) |
CAS-nummer |
3879-08-1 |
Molecular Structure |
|
Tetthet |
1.161g/cm3 |
Smeltepunkt |
92-93℃ |
Kokepunkt |
377.5°C at 760 mmHg |
Brytningsindeks |
1.487 |
Flammepunktet |
182.1°C |
Damptrykk |
3.03E-07mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|