ChemNet > CAS > 39769-09-0 4,4'-Difluorobenzylideneaniline
39769-09-0 4,4'-Difluorobenzylideneaniline
| produktnavn |
4,4'-Difluorobenzylideneaniline |
| Engelsk navn |
4,4'-Difluorobenzylideneaniline;4-fluoro-N-[(1E)-(4-fluorophenyl)methylidene]aniline |
| Molekylær Formel |
C13H9F2N |
| Molekylvekt |
217.2141 |
| InChI |
InChI=1/C13H9F2N/c14-11-3-1-10(2-4-11)9-16-13-7-5-12(15)6-8-13/h1-9H/b16-9+ |
| CAS-nummer |
39769-09-0 |
| Molecular Structure |
|
| Tetthet |
1.11g/cm3 |
| Smeltepunkt |
64℃ |
| Kokepunkt |
307.4°C at 760 mmHg |
| Brytningsindeks |
1.527 |
| Flammepunktet |
139.7°C |
| Damptrykk |
0.00132mmHg at 25°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
