39905-44-7 p-Heptyloxyaniline
produktnavn |
p-Heptyloxyaniline |
Engelsk navn |
p-Heptyloxyaniline; 4-n-Heptyloxyaniline; 4-(heptyloxy)aniline |
Molekylær Formel |
C13H21NO |
Molekylvekt |
207.3119 |
InChI |
InChI=1/C13H21NO/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10H,2-6,11,14H2,1H3 |
CAS-nummer |
39905-44-7 |
Molecular Structure |
|
Tetthet |
0.965g/cm3 |
Kokepunkt |
325.9°C at 760 mmHg |
Brytningsindeks |
1.516 |
Flammepunktet |
145°C |
Damptrykk |
0.000223mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|