ChemNet > CAS > 39905-44-7 p-Heptyloxyaniline
39905-44-7 p-Heptyloxyaniline
| produktnavn |
p-Heptyloxyaniline |
| Engelsk navn |
p-Heptyloxyaniline; 4-n-Heptyloxyaniline; 4-(heptyloxy)aniline |
| Molekylær Formel |
C13H21NO |
| Molekylvekt |
207.3119 |
| InChI |
InChI=1/C13H21NO/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10H,2-6,11,14H2,1H3 |
| CAS-nummer |
39905-44-7 |
| Molecular Structure |
|
| Tetthet |
0.965g/cm3 |
| Kokepunkt |
325.9°C at 760 mmHg |
| Brytningsindeks |
1.516 |
| Flammepunktet |
145°C |
| Damptrykk |
0.000223mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
