ChemNet > CAS > 39943-56-1 3,5-Dichlorophenylhydrazine
39943-56-1 3,5-Dichlorophenylhydrazine
| produktnavn |
3,5-Dichlorophenylhydrazine |
| Engelsk navn |
3,5-Dichlorophenylhydrazine; |
| Molekylær Formel |
C6H6Cl2N2 |
| Molekylvekt |
177.0312 |
| InChI |
InChI=1/C6H6Cl2N2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,10H,9H2 |
| CAS-nummer |
39943-56-1 |
| Molecular Structure |
|
| Tetthet |
1.475g/cm3 |
| Kokepunkt |
286.1°C at 760 mmHg |
| Brytningsindeks |
1.665 |
| Flammepunktet |
126.8°C |
| Damptrykk |
0.0027mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
