ChemNet > CAS > 39969-57-8 1-Bromo-4-butoxybenzene
39969-57-8 1-Bromo-4-butoxybenzene
produktnavn |
1-Bromo-4-butoxybenzene |
Engelsk navn |
1-Bromo-4-butoxybenzene; p-Bromophenyl Butyl Ether; p-Butoxybromobenzene |
Molekylær Formel |
C10H13BrO |
Molekylvekt |
229.1136 |
InChI |
InChI=1/C10H13BrO/c1-2-3-8-12-10-6-4-9(11)5-7-10/h4-7H,2-3,8H2,1H3 |
CAS-nummer |
39969-57-8 |
Molecular Structure |
|
Tetthet |
1.278g/cm3 |
Kokepunkt |
263.9°C at 760 mmHg |
Brytningsindeks |
1.52 |
Flammepunktet |
114.7°C |
Damptrykk |
0.0163mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|