ChemNet > CAS > 402-63-1 1-(3-fluorophenyl)ethanol
402-63-1 1-(3-fluorophenyl)ethanol
produktnavn |
1-(3-fluorophenyl)ethanol |
Engelsk navn |
1-(3-fluorophenyl)ethanol; 3-fluorophenyl methyl carbinol; 3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol; 3-Fluoro-α-methylbenzenemethanol |
Molekylær Formel |
C8H9FO |
Molekylvekt |
140.1549 |
InChI |
InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
CAS-nummer |
402-63-1 |
EINECS |
206-950-4 |
Molecular Structure |
|
Tetthet |
1.123g/cm3 |
Kokepunkt |
196.2°C at 760 mmHg |
Brytningsindeks |
1.51 |
Flammepunktet |
90.1°C |
Damptrykk |
0.251mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|