402-64-2 3-fluorobenzal chloride

produktnavn	3-fluorobenzal chloride
Engelsk navn	3-fluorobenzal chloride; alpha,alpha-Dichloro-3-fluorotoluene
Molekylær Formel	C₇H₅Cl₂F
Molekylvekt	179.02
InChI	InChI=1/C7H5Cl2F/c8-7(9)5-2-1-3-6(10)4-5/h1-4,7H
CAS-nummer	402-64-2
EINECS	206-952-5
Molecular Structure
Kokepunkt	195℃
Hazard symboler
Risiko Koder	R34:Causes burns.; R36:Irritating to eyes.;
Sikkerhet Beskrivelse	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;