ChemNet > CAS > 40400-15-5 2-Iodophenylacetonitrile
40400-15-5 2-Iodophenylacetonitrile
| produktnavn |
2-Iodophenylacetonitrile |
| Engelsk navn |
2-Iodophenylacetonitrile; 2-Iodobenzyl cyanide |
| Molekylær Formel |
C8H6IN |
| Molekylvekt |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5H2 |
| CAS-nummer |
40400-15-5 |
| Molecular Structure |
|
| Tetthet |
1.764g/cm3 |
| Kokepunkt |
306°C at 760 mmHg |
| Brytningsindeks |
1.624 |
| Flammepunktet |
138.8°C |
| Damptrykk |
0.000795mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
