4079-52-1 2-Methoxyacetophenone
produktnavn |
2-Methoxyacetophenone |
Engelsk navn |
2-Methoxyacetophenone; 2-Acetylanisole; alpha-Methoxyacetophenone; 2-methoxy-1-phenylethanone; 1-(2-methoxyphenyl)ethanone |
Molekylær Formel |
C9H10O2 |
Molekylvekt |
150.1745 |
InChI |
InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
CAS-nummer |
4079-52-1 |
EINECS |
223-802-4 |
Molecular Structure |
|
Tetthet |
1.035g/cm3 |
Smeltepunkt |
7-8℃ |
Kokepunkt |
245°C at 760 mmHg |
Brytningsindeks |
1.504 |
Flammepunktet |
92.8°C |
Damptrykk |
0.0294mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|