4144-62-1 5-Benzoylpentanoic acid
produktnavn |
5-Benzoylpentanoic acid |
Engelsk navn |
5-Benzoylpentanoic acid; 6-Oxo-6-phenylhexanoic acid |
Molekylær Formel |
C12H14O3 |
Molekylvekt |
206.2378 |
InChI |
InChI=1/C12H14O3/c13-11(8-4-5-9-12(14)15)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,14,15) |
CAS-nummer |
4144-62-1 |
Molecular Structure |
|
Tetthet |
1.135g/cm3 |
Kokepunkt |
385.3°C at 760 mmHg |
Brytningsindeks |
1.533 |
Flammepunktet |
201°C |
Damptrykk |
1.26E-06mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|