ChemNet > CAS > 42048-11-3 2-Chloro-6-iodotoluene
42048-11-3 2-Chloro-6-iodotoluene
| produktnavn |
2-Chloro-6-iodotoluene |
| Engelsk navn |
2-Chloro-6-iodotoluene; 1-Chloro-3-iodo-2-methylbenzene; 2-Iodo-6-chlorotoluene |
| Molekylær Formel |
C7H6ClI |
| Molekylvekt |
252.48 |
| InChI |
InChI=1/C7H6ClI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| CAS-nummer |
42048-11-3 |
| Molecular Structure |
|
| Tetthet |
1.806g/cm3 |
| Kokepunkt |
243°C at 760 mmHg |
| Brytningsindeks |
1.616 |
| Flammepunktet |
100.8°C |
| Damptrykk |
0.0513mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
