ChemNet > CAS > 42087-80-9 metyl-4-klor-2-nitrobenzoat
42087-80-9 metyl-4-klor-2-nitrobenzoat
| produktnavn |
metyl-4-klor-2-nitrobenzoat |
| Synonymer |
; 4-klor-2-nitrobenzoesyremetylester |
| Engelsk navn |
Methyl 4-Chloro-2-Nitrobenzoate; 4-Chloro-2-nitrobenzoic acid methyl ester |
| Molekylær Formel |
C8H6ClNO4 |
| Molekylvekt |
215.5905 |
| InChI |
InChI=1/C8H6ClNO4/c1-14-8(11)6-3-2-5(9)4-7(6)10(12)13/h2-4H,1H3 |
| CAS-nummer |
42087-80-9 |
| EINECS |
255-654-1 |
| Molecular Structure |
|
| Tetthet |
1.426g/cm3 |
| Smeltepunkt |
43-45℃ |
| Kokepunkt |
285.6°C at 760 mmHg |
| Brytningsindeks |
1.568 |
| Flammepunktet |
126.5°C |
| Damptrykk |
0.00277mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
