ChemNet > CAS > 42754-62-1 5-amino-3-(4-klorfenyl)-1H-pyrazol-4-karbonitril
42754-62-1 5-amino-3-(4-klorfenyl)-1H-pyrazol-4-karbonitril
| produktnavn |
5-amino-3-(4-klorfenyl)-1H-pyrazol-4-karbonitril |
| Synonymer |
3-amino-5-(4-klorfenyl)-1H-pyrazol-4-karbonitril |
| Engelsk navn |
5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile;3-amino-5-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| Molekylær Formel |
C10H7ClN4 |
| Molekylvekt |
218.6424 |
| InChI |
InChI=1/C10H7ClN4/c11-7-3-1-6(2-4-7)9-8(5-12)10(13)15-14-9/h1-4H,(H3,13,14,15) |
| CAS-nummer |
42754-62-1 |
| Molecular Structure |
|
| Tetthet |
1.48g/cm3 |
| Smeltepunkt |
212℃ |
| Kokepunkt |
554.7°C at 760 mmHg |
| Brytningsindeks |
1.688 |
| Flammepunktet |
289.3°C |
| Damptrykk |
2.41E-12mmHg at 25°C |
| Hazard symboler |
Xn:Harmful;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|