ChemNet > CAS > 4376-18-5 Methyl hydrogen phthalate
4376-18-5 Methyl hydrogen phthalate
| produktnavn |
Methyl hydrogen phthalate |
| Engelsk navn |
Methyl hydrogen phthalate; Monomethyl phthalate~Phthalic acid monomethyl ester; mono-Methyl phthalate; Phthalic acid monomethyl ester; Benzene-1,2-dicarboxylic acid monomethyl ester~Monomethyl phthalate~Phthalic acid monomethyl ester; 2-(methoxycarbonyl)benzoic acid; 2-(methoxycarbonyl)benzoate |
| Molekylær Formel |
C9H7O4 |
| Molekylvekt |
179.15 |
| InChI |
InChI=1/C9H8O4/c1-13-9(12)7-5-3-2-4-6(7)8(10)11/h2-5H,1H3,(H,10,11)/p-1 |
| CAS-nummer |
4376-18-5 |
| EINECS |
224-476-6 |
| Molecular Structure |
|
| Smeltepunkt |
81-84℃ |
| Kokepunkt |
328.9°C at 760 mmHg |
| Flammepunktet |
134.7°C |
| Damptrykk |
7.39E-05mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
