ChemNet > CAS > 4395-87-3 4-Isopropylphenylacetonitrile
4395-87-3 4-Isopropylphenylacetonitrile
| produktnavn |
4-Isopropylphenylacetonitrile |
| Engelsk navn |
4-Isopropylphenylacetonitrile; [4-(propan-2-yl)phenyl]acetonitrile; 4-Isopropylphenylaceotnitrile |
| Molekylær Formel |
C11H13N |
| Molekylvekt |
159.2276 |
| InChI |
InChI=1/C11H13N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7H2,1-2H3 |
| CAS-nummer |
4395-87-3 |
| Molecular Structure |
|
| Tetthet |
0.96g/cm3 |
| Kokepunkt |
261.1°C at 760 mmHg |
| Brytningsindeks |
1.514 |
| Flammepunktet |
117.5°C |
| Damptrykk |
0.0118mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
