ChemNet > CAS > 4402-83-9 metyl 3-(2,6-diklorfenyl)-5-metylisoksazol-4-karboksylat
4402-83-9 metyl 3-(2,6-diklorfenyl)-5-metylisoksazol-4-karboksylat
| produktnavn |
metyl 3-(2,6-diklorfenyl)-5-metylisoksazol-4-karboksylat |
| Synonymer |
metyl 3-(2,6-diklorfenyl)-5-metyl-1,2-oksazol-4-karboksylat |
| Engelsk navn |
methyl 3-(2,6-dichlorophenyl)-5-methylisoxazole-4-carboxylate;methyl 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| Molekylær Formel |
C12H9Cl2NO3 |
| Molekylvekt |
286.1108 |
| InChI |
InChI=1/C12H9Cl2NO3/c1-6-9(12(16)17-2)11(15-18-6)10-7(13)4-3-5-8(10)14/h3-5H,1-2H3 |
| CAS-nummer |
4402-83-9 |
| Molecular Structure |
|
| Tetthet |
1.37g/cm3 |
| Smeltepunkt |
115℃ |
| Kokepunkt |
382.4°C at 760 mmHg |
| Brytningsindeks |
1.561 |
| Flammepunktet |
185.1°C |
| Damptrykk |
4.72E-06mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
