4433-30-1 Undecanophenone
produktnavn |
Undecanophenone |
Engelsk navn |
Undecanophenone; n-Decyl phenyl ketone; 1-phenylundecan-2-one |
Molekylær Formel |
C17H26O |
Molekylvekt |
246.3877 |
InChI |
InChI=1/C17H26O/c1-2-3-4-5-6-7-11-14-17(18)15-16-12-9-8-10-13-16/h8-10,12-13H,2-7,11,14-15H2,1H3 |
CAS-nummer |
4433-30-1 |
EINECS |
224-633-9 |
Molecular Structure |
|
Tetthet |
0.92g/cm3 |
Smeltepunkt |
28-30℃ |
Kokepunkt |
342.846°C at 760 mmHg |
Brytningsindeks |
1.49 |
Flammepunktet |
114.968°C |
Damptrykk |
0mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|