ChemNet > CAS > 45534-08-5 3-Amino-5-methylthio-1H-1,2,4-triazole
45534-08-5 3-Amino-5-methylthio-1H-1,2,4-triazole
produktnavn |
3-Amino-5-methylthio-1H-1,2,4-triazole |
Engelsk navn |
3-Amino-5-methylthio-1H-1,2,4-triazole; |
Molekylær Formel |
C3H6N4S |
Molekylvekt |
130.1715 |
InChI |
InChI=1/C3H6N4S/c1-8-3-5-2(4)6-7-3/h1H3,(H3,4,5,6,7) |
CAS-nummer |
45534-08-5 |
EINECS |
256-242-4 |
Molecular Structure |
|
Tetthet |
1.46g/cm3 |
Smeltepunkt |
130-133℃ |
Kokepunkt |
393.7°C at 760 mmHg |
Brytningsindeks |
1.652 |
Flammepunktet |
191.9°C |
Damptrykk |
2.08E-06mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|