ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
| produktnavn |
2-aminothiophene-3-carbonitrile |
| Engelsk navn |
2-aminothiophene-3-carbonitrile; 2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
| Molekylær Formel |
C5H4N2S |
| Molekylvekt |
124.1637 |
| InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
| CAS-nummer |
4651-82-5 |
| Molecular Structure |
|
| Tetthet |
1.33g/cm3 |
| Smeltepunkt |
104℃ |
| Kokepunkt |
317.5°C at 760 mmHg |
| Brytningsindeks |
1.627 |
| Flammepunktet |
145.8°C |
| Damptrykk |
0.000384mmHg at 25°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
