ChemNet > CAS > 4651-97-2 2-amino-4-methylthiophene-3-carboxamide
4651-97-2 2-amino-4-methylthiophene-3-carboxamide
produktnavn |
2-amino-4-methylthiophene-3-carboxamide |
Engelsk navn |
2-amino-4-methylthiophene-3-carboxamide; |
Molekylær Formel |
C6H8N2OS |
Molekylvekt |
156.2055 |
InChI |
InChI=1/C6H8N2OS/c1-3-2-10-6(8)4(3)5(7)9/h2H,8H2,1H3,(H2,7,9) |
CAS-nummer |
4651-97-2 |
Molecular Structure |
|
Tetthet |
1.344g/cm3 |
Smeltepunkt |
173℃ |
Kokepunkt |
277.1°C at 760 mmHg |
Brytningsindeks |
1.654 |
Flammepunktet |
121.4°C |
Damptrykk |
0.00462mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|