4705-34-4 4,4'-Dimethoxystilbene
produktnavn |
4,4'-Dimethoxystilbene |
Engelsk navn |
4,4'-Dimethoxystilbene; 1-methoxy-4-((E)-2-(4-methoxyphenyl)ethenyl)benzene
; 1,1'-ethene-1,2-diylbis(4-methoxybenzene); 1,1'-(E)-ethene-1,2-diylbis(4-methoxybenzene) |
Molekylær Formel |
C16H16O2 |
Molekylvekt |
240.297 |
InChI |
InChI=1/C16H16O2/c1-17-15-9-5-13(6-10-15)3-4-14-7-11-16(18-2)12-8-14/h3-12H,1-2H3/b4-3+ |
CAS-nummer |
4705-34-4 |
EINECS |
225-189-9 |
Molecular Structure |
|
Tetthet |
1.089g/cm3 |
Smeltepunkt |
213-215℃ |
Kokepunkt |
391.3°C at 760 mmHg |
Brytningsindeks |
1.615 |
Flammepunktet |
159.3°C |
Damptrykk |
5.61E-06mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|