4819-77-6 Triethoxyethane
produktnavn |
Triethoxyethane |
Engelsk navn |
Triethoxyethane; 1,1,2-Triethoxyethane; Ethoxyacetaldehyde diethyl acetal |
Molekylær Formel |
C8H18O3 |
Molekylvekt |
162.2267 |
InChI |
InChI=1/C8H18O3/c1-4-9-7-8(10-5-2)11-6-3/h8H,4-7H2,1-3H3 |
CAS-nummer |
4819-77-6 |
EINECS |
225-394-3 |
Molecular Structure |
|
Tetthet |
0.901g/cm3 |
Kokepunkt |
180.9°C at 760 mmHg |
Brytningsindeks |
1.406 |
Flammepunktet |
59.6°C |
Damptrykk |
1.19mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R10:Flammable.;
|
Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|