484-17-3 9-Phenanthrol
produktnavn |
9-Phenanthrol |
Engelsk navn |
9-Phenanthrol; 9-Hydroxyphenanthrene; phenanthren-9-ol |
Molekylær Formel |
C14H10O |
Molekylvekt |
194.2286 |
InChI |
InChI=1/C14H10O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,15H |
CAS-nummer |
484-17-3 |
EINECS |
207-602-4 |
Molecular Structure |
|
Tetthet |
1.244g/cm3 |
Smeltepunkt |
139-143℃ |
Kokepunkt |
404.5°C at 760 mmHg |
Brytningsindeks |
1.753 |
Flammepunktet |
197.7°C |
Damptrykk |
4.02E-07mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|