487-26-3 Flavanone
produktnavn |
Flavanone |
Engelsk navn |
Flavanone; 2,3-Dihydroflavone~2-Phenylchromanone; 2,3-dihydro-2-phenylchroman-4-one; 2,3-Dihydroflavone; 2-phenyl-2,3-dihydro-4H-chromen-4-one; (2S)-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2R)-2-phenyl-2,3-dihydro-4H-chromen-4-one; DL-Flavanone |
Molekylær Formel |
C15H12O2 |
Molekylvekt |
224.2546 |
InChI |
InChI=1/C15H12O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-9,15H,10H2/t15-/m1/s1 |
CAS-nummer |
487-26-3 |
EINECS |
207-654-8 |
Molecular Structure |
|
Tetthet |
1.192g/cm3 |
Smeltepunkt |
75-78℃ |
Kokepunkt |
386.2°C at 760 mmHg |
Brytningsindeks |
1.603 |
Flammepunktet |
181.9°C |
Damptrykk |
3.6E-06mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|