488-87-9 2,5-dimetylresorcinol
produktnavn |
2,5-dimetylresorcinol |
Synonymer |
2,5-dimetylbenzen-1,3-diol |
Engelsk navn |
2,5-Dimethylresorcinol;2,5-dimethylbenzene-1,3-diol |
Molekylær Formel |
C8H10O2 |
Molekylvekt |
138.1638 |
InChI |
InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
CAS-nummer |
488-87-9 |
EINECS |
207-688-3 |
Molecular Structure |
|
Tetthet |
1.162g/cm3 |
Smeltepunkt |
161℃ |
Kokepunkt |
284.1°C at 760 mmHg |
Brytningsindeks |
1.582 |
Flammepunktet |
140.8°C |
Damptrykk |
0.00178mmHg at 25°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|