ChemNet > CAS > 4884-24-6 Cyclopentylcyclopentanon
4884-24-6 Cyclopentylcyclopentanon
produktnavn |
Cyclopentylcyclopentanon |
Engelsk navn |
Cyclopentylcyclopentanon; 2-Cyclopentylcyclopentanone; 1,1'-bi(cyclopentyl)-2-one |
Molekylær Formel |
C10H16O |
Molekylvekt |
152.2334 |
InChI |
InChI=1/C10H16O/c11-10-7-3-6-9(10)8-4-1-2-5-8/h8-9H,1-7H2 |
CAS-nummer |
4884-24-6 |
EINECS |
225-495-2 |
Molecular Structure |
|
Tetthet |
1.031g/cm3 |
Kokepunkt |
232.5°C at 760 mmHg |
Brytningsindeks |
1.512 |
Flammepunktet |
90.3°C |
Damptrykk |
0.0588mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|