ChemNet > CAS > 492-99-9 1,2-Cyclohexanedione dioxime
492-99-9 1,2-Cyclohexanedione dioxime
produktnavn |
1,2-Cyclohexanedione dioxime |
Engelsk navn |
1,2-Cyclohexanedione dioxime; Nioxime?Nioxime(rg; N-hydroxy-2-nitrosocyclohex-1-en-1-amine; (1E,2E)-N,N'-dihydroxycyclohexane-1,2-diimine; (1Z,2E)-N,N'-dihydroxycyclohexane-1,2-diimine |
Molekylær Formel |
C6H10N2O2 |
Molekylvekt |
142.1558 |
InChI |
InChI=1/C6H10N2O2/c9-7-5-3-1-2-4-6(5)8-10/h9-10H,1-4H2/b7-5-,8-6+ |
CAS-nummer |
492-99-9 |
EINECS |
207-769-3 |
Molecular Structure |
|
Tetthet |
1.361g/cm3 |
Smeltepunkt |
181-188℃ |
Kokepunkt |
339.042°C at 760 mmHg |
Brytningsindeks |
1.594 |
Flammepunktet |
210.08°C |
Damptrykk |
0mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|