4920-34-7 2,3,6-Trifluoroanisole
produktnavn |
2,3,6-Trifluoroanisole |
Engelsk navn |
2,3,6-Trifluoroanisole; 3-Methoxy-1,2,4-trifluorobenzene; 1,2,4-trifluoro-3-methoxybenzene |
Molekylær Formel |
C7H5F3O |
Molekylvekt |
162.1092 |
InChI |
InChI=1/C7H5F3O/c1-11-7-5(9)3-2-4(8)6(7)10/h2-3H,1H3 |
CAS-nummer |
4920-34-7 |
Molecular Structure |
|
Tetthet |
1.285g/cm3 |
Kokepunkt |
147.7°C at 760 mmHg |
Brytningsindeks |
1.435 |
Flammepunktet |
49.1°C |
Damptrykk |
5.53mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R10:Flammable.;
|
Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|