ChemNet > CAS > 496-76-4 2,4,5-Trihydroxypyrimidine
496-76-4 2,4,5-Trihydroxypyrimidine
produktnavn |
2,4,5-Trihydroxypyrimidine |
Engelsk navn |
2,4,5-Trihydroxypyrimidine; Isobarbituric acid; 5-hydroxypyrimidine-2,4(1H,3H)-dione; dihydropyrimidine-2,4,5(3H)-trione |
Molekylær Formel |
C4H4N2O3 |
Molekylvekt |
128.0862 |
InChI |
InChI=1/C4H4N2O3/c7-2-1-5-4(9)6-3(2)8/h1H2,(H2,5,6,8,9) |
CAS-nummer |
496-76-4 |
EINECS |
207-829-9 |
Molecular Structure |
|
Tetthet |
1.455g/cm3 |
Smeltepunkt |
300℃ |
Brytningsindeks |
1.492 |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|