ChemNet > CAS > 4981-63-9 4'-Chlorobutyrophenone
4981-63-9 4'-Chlorobutyrophenone
| produktnavn |
4'-Chlorobutyrophenone |
| Engelsk navn |
4'-Chlorobutyrophenone; 1-(4-Chlorophenyl)-1-butanone; 4-Chlorobutyrophenone; 1-(4-chlorophenyl)butan-1-one; 4-chloro-1-phenylbutan-1-one |
| Molekylær Formel |
C10H11ClO |
| Molekylvekt |
182.6467 |
| InChI |
InChI=1/C10H11ClO/c11-8-4-7-10(12)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| CAS-nummer |
4981-63-9 |
| EINECS |
225-631-0 |
| Molecular Structure |
|
| Tetthet |
1.104g/cm3 |
| Smeltepunkt |
36-39℃ |
| Kokepunkt |
285.9°C at 760 mmHg |
| Brytningsindeks |
1.521 |
| Flammepunktet |
145.5°C |
| Damptrykk |
0.00272mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
