ChemNet > CAS > 499770-76-2 5-(Bromomethyl)-1-methyl-1H-1,2,3-benzotriazole
499770-76-2 5-(Bromomethyl)-1-methyl-1H-1,2,3-benzotriazole
produktnavn |
5-(Bromomethyl)-1-methyl-1H-1,2,3-benzotriazole |
Engelsk navn |
5-(Bromomethyl)-1-methyl-1H-1,2,3-benzotriazole; 5-(bromomethyl)-1-methyl-1H-benzo[d][1,2,3]triazole; 5-(Bromomethyl)-1-methyl-1H-benzotriazole; 5-(bromomethyl)-1-methyl-benzotriazole |
Molekylær Formel |
C8H8BrN3 |
Molekylvekt |
226.0732 |
InChI |
InChI=1/C8H8BrN3/c1-12-8-3-2-6(5-9)4-7(8)10-11-12/h2-4H,5H2,1H3 |
CAS-nummer |
499770-76-2 |
Molecular Structure |
|
Tetthet |
1.66g/cm3 |
Smeltepunkt |
115℃ |
Kokepunkt |
355.735°C at 760 mmHg |
Brytningsindeks |
1.685 |
Flammepunktet |
168.943°C |
Damptrykk |
0mmHg at 25°C |
Hazard symboler |
C:Corrosive;
|
Risiko Koder |
R34:Causes burns.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|